C26H45NO4S — CID 23393076
4-(3,4-dioctoxyphenyl)-1,4-thiazinane 1,1-dioxide (PubChem CID 23393076) has the molecular formula C26H45NO4S and a molecular weight of 467.72 g/mol. Its IUPAC name is 4-(3,4-dioctoxyphenyl)-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-(3,4-dioctoxyphenyl)-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 23393076 |
| Molecular Formula | C26H45NO4S |
| Molecular Weight | 467.72 g/mol |
| Exact Mass | 467.31 |
| IUPAC Name | 4-(3,4-dioctoxyphenyl)-1,4-thiazinane 1,1-dioxide |
| SMILES | CCCCCCCCOc1ccc(N2CCS(=O)(=O)CC2)cc1OCCCCCCCC |
| InChI | InChI=1S/C26H45NO4S/c1-3-5-7-9-11-13-19-30-25-16-15-24(27-17-21-32(28,29)22-18-27)23-26(25)31-20-14-12-10-8-6-4-2/h15-16,23H,3-14,17-22H2,1-2H3 |
| InChIKey | NFWPYAFUPCMMPY-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.72 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|