C22H26N4OS — CID 2339381
(4S)-4-[4-(dimethylamino)phenyl]-1,3,6-trimethyl-N-phenyl-2-sulfanylidene-4H-pyrimidine-5-carboxamide (PubChem CID 2339381) has the molecular formula C22H26N4OS and a molecular weight of 394.54 g/mol. Its IUPAC name is (4S)-4-[4-(dimethylamino)phenyl]-1,3,6-trimethyl-N-phenyl-2-sulfanylidene-4H-pyrimidine-5-carboxamide.
| Compound Name | (4S)-4-[4-(dimethylamino)phenyl]-1,3,6-trimethyl-N-phenyl-2-sulfanylidene-4H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 2339381 |
| Molecular Formula | C22H26N4OS |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | (4S)-4-[4-(dimethylamino)phenyl]-1,3,6-trimethyl-N-phenyl-2-sulfanylidene-4H-pyrimidine-5-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2)[C@H](c2ccc(N(C)C)cc2)N(C)C(=S)N1C |
| InChI | InChI=1S/C22H26N4OS/c1-15-19(21(27)23-17-9-7-6-8-10-17)20(26(5)22(28)25(15)4)16-11-13-18(14-12-16)24(2)3/h6-14,20H,1-5H3,(H,23,27)/t20-/m0/s1 |
| InChIKey | XFAMQHBWXYZACH-FQEVSTJZSA-N |
| XLogP | 3.87 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|