C18H21N3OS — CID 35527030
(2R)-2-[4-(dimethylamino)phenyl]-N-phenyl-1,3-thiazolidine-3-carboxamide (PubChem CID 35527030) has the molecular formula C18H21N3OS and a molecular weight of 327.45 g/mol. Its IUPAC name is (2R)-2-[4-(dimethylamino)phenyl]-N-phenyl-1,3-thiazolidine-3-carboxamide.
| Compound Name | (2R)-2-[4-(dimethylamino)phenyl]-N-phenyl-1,3-thiazolidine-3-carboxamide |
|---|---|
| PubChem CID | 35527030 |
| Molecular Formula | C18H21N3OS |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | (2R)-2-[4-(dimethylamino)phenyl]-N-phenyl-1,3-thiazolidine-3-carboxamide |
| SMILES | CN(C)c1ccc([C@H]2SCCN2C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C18H21N3OS/c1-20(2)16-10-8-14(9-11-16)17-21(12-13-23-17)18(22)19-15-6-4-3-5-7-15/h3-11,17H,12-13H2,1-2H3,(H,19,22)/t17-/m1/s1 |
| InChIKey | YMDQRIPNKFERJL-QGZVFWFLSA-N |
| XLogP | 4.03 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|