C27H19F6N2O3+ — CID 23396021
[1-[(4-nitrophenyl)methyl]pyridin-1-ium-4-yl]-bis[4-(trifluoromethyl)phenyl]methanol (PubChem CID 23396021) has the molecular formula C27H19F6N2O3+ and a molecular weight of 533.45 g/mol. Its IUPAC name is [1-[(4-nitrophenyl)methyl]pyridin-1-ium-4-yl]-bis[4-(trifluoromethyl)phenyl]methanol.
| Compound Name | [1-[(4-nitrophenyl)methyl]pyridin-1-ium-4-yl]-bis[4-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 23396021 |
| Molecular Formula | C27H19F6N2O3+ |
| Molecular Weight | 533.45 g/mol |
| Exact Mass | 533.13 |
| IUPAC Name | [1-[(4-nitrophenyl)methyl]pyridin-1-ium-4-yl]-bis[4-(trifluoromethyl)phenyl]methanol |
| SMILES | O=[N+]([O-])c1ccc(C[n+]2ccc(C(O)(c3ccc(C(F)(F)F)cc3)c3ccc(C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C27H19F6N2O3/c28-26(29,30)22-7-3-19(4-8-22)25(36,20-5-9-23(10-6-20)27(31,32)33)21-13-15-34(16-14-21)17-18-1-11-24(12-2-18)35(37)38/h1-16,36H,17H2/q+1 |
| InChIKey | CJSVQKYIOWNCEU-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 67.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.45 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|