C8H9Br3O2 — CID 23396655
3,5-dibromo-5-(bromomethyl)-4-propylfuran-2-one (PubChem CID 23396655) has the molecular formula C8H9Br3O2 and a molecular weight of 376.87 g/mol. Its IUPAC name is 3,5-dibromo-5-(bromomethyl)-4-propylfuran-2-one.
| Compound Name | 3,5-dibromo-5-(bromomethyl)-4-propylfuran-2-one |
|---|---|
| PubChem CID | 23396655 |
| Molecular Formula | C8H9Br3O2 |
| Molecular Weight | 376.87 g/mol |
| Exact Mass | 373.82 |
| IUPAC Name | 3,5-dibromo-5-(bromomethyl)-4-propylfuran-2-one |
| SMILES | CCCC1=C(Br)C(=O)OC1(Br)CBr |
| InChI | InChI=1S/C8H9Br3O2/c1-2-3-5-6(10)7(12)13-8(5,11)4-9/h2-4H2,1H3 |
| InChIKey | UFTXCLNLFSGSRY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.87 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|