C28H40O7 — CID 23396718
[2-[2,2-bis(but-3-enyl)hex-5-enoxymethyl]-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate (PubChem CID 23396718) has the molecular formula C28H40O7 and a molecular weight of 488.62 g/mol. Its IUPAC name is [2-[2,2-bis(but-3-enyl)hex-5-enoxymethyl]-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate.
| Compound Name | [2-[2,2-bis(but-3-enyl)hex-5-enoxymethyl]-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate |
|---|---|
| PubChem CID | 23396718 |
| Molecular Formula | C28H40O7 |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | [2-[2,2-bis(but-3-enyl)hex-5-enoxymethyl]-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate |
| SMILES | C=CCCC(CCC=C)(CCC=C)COCC(COC(=O)C=C)(COC(=O)C=C)COC(=O)C=C |
| InChI | InChI=1S/C28H40O7/c1-7-13-16-27(17-14-8-2,18-15-9-3)19-32-20-28(21-33-24(29)10-4,22-34-25(30)11-5)23-35-26(31)12-6/h7-12H,1-6,13-23H2 |
| InChIKey | NALRRJFRVDEKAO-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|