C6H9NO2 — CID 23397168
3-ethyl-4-methyl-4H-1,2-oxazol-5-one (PubChem CID 23397168) has the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. Its IUPAC name is 3-ethyl-4-methyl-4H-1,2-oxazol-5-one.
| Compound Name | 3-ethyl-4-methyl-4H-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 23397168 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | 3-ethyl-4-methyl-4H-1,2-oxazol-5-one |
| SMILES | CCC1=NOC(=O)C1C |
| InChI | InChI=1S/C6H9NO2/c1-3-5-4(2)6(8)9-7-5/h4H,3H2,1-2H3 |
| InChIKey | KOQGOHGHIDJVDX-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|