About (propan-2-ylideneamino) 2-ethylpentanoate
(propan-2-ylideneamino) 2-ethylpentanoate (PubChem CID 18716588) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is (propan-2-ylideneamino) 2-ethylpentanoate.
Molecular Properties
| Compound Name | (propan-2-ylideneamino) 2-ethylpentanoate |
| PubChem CID | 18716588 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | (propan-2-ylideneamino) 2-ethylpentanoate |
| SMILES | CCCC(CC)C(=O)ON=C(C)C |
| InChI | InChI=1S/C10H19NO2/c1-5-7-9(6-2)10(12)13-11-8(3)4/h9H,5-7H2,1-4H3 |
| InChIKey | FRIMDGPVFCGQRX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (propan-2-ylideneamino) 2-ethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (propan-2-ylideneamino) 2-ethylpentanoate?
The IUPAC name of (propan-2-ylideneamino) 2-ethylpentanoate (CID 18716588) is (propan-2-ylideneamino) 2-ethylpentanoate.
What is the SMILES notation for (propan-2-ylideneamino) 2-ethylpentanoate?
The canonical SMILES for (propan-2-ylideneamino) 2-ethylpentanoate is CCCC(CC)C(=O)ON=C(C)C.
What is the InChIKey of (propan-2-ylideneamino) 2-ethylpentanoate?
The InChIKey is FRIMDGPVFCGQRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2/c1-5-7-9(6-2)10(12)13-11-8(3)4/h9H,5-7H2,1-4H3.
What are the key properties of (propan-2-ylideneamino) 2-ethylpentanoate?
(propan-2-ylideneamino) 2-ethylpentanoate has a molecular weight of 185.27 g/mol, XLogP of 2.75, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (propan-2-ylideneamino) 2-ethylpentanoate is sourced from PubChem (CID 18716588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).