C16H14ClF3OS — CID 23399169
3-[2-chloro-4-[3-(trifluoromethyl)phenyl]sulfanylphenyl]propan-1-ol (PubChem CID 23399169) has the molecular formula C16H14ClF3OS and a molecular weight of 346.80 g/mol. Its IUPAC name is 3-[2-chloro-4-[3-(trifluoromethyl)phenyl]sulfanylphenyl]propan-1-ol.
| Compound Name | 3-[2-chloro-4-[3-(trifluoromethyl)phenyl]sulfanylphenyl]propan-1-ol |
|---|---|
| PubChem CID | 23399169 |
| Molecular Formula | C16H14ClF3OS |
| Molecular Weight | 346.80 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 3-[2-chloro-4-[3-(trifluoromethyl)phenyl]sulfanylphenyl]propan-1-ol |
| SMILES | OCCCc1ccc(Sc2cccc(C(F)(F)F)c2)cc1Cl |
| InChI | InChI=1S/C16H14ClF3OS/c17-15-10-14(7-6-11(15)3-2-8-21)22-13-5-1-4-12(9-13)16(18,19)20/h1,4-7,9-10,21H,2-3,8H2 |
| InChIKey | REHDRKLIXAGASB-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.80 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |