C19H21ClF3NOS — CID 25030105
2-amino-5-[2-chloro-4-[3-(trifluoromethyl)phenyl]sulfanylphenyl]-2-methylpentan-1-ol (PubChem CID 25030105) has the molecular formula C19H21ClF3NOS and a molecular weight of 403.90 g/mol. Its IUPAC name is 2-amino-5-[2-chloro-4-[3-(trifluoromethyl)phenyl]sulfanylphenyl]-2-methylpentan-1-ol.
| Compound Name | 2-amino-5-[2-chloro-4-[3-(trifluoromethyl)phenyl]sulfanylphenyl]-2-methylpentan-1-ol |
|---|---|
| PubChem CID | 25030105 |
| Molecular Formula | C19H21ClF3NOS |
| Molecular Weight | 403.90 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 2-amino-5-[2-chloro-4-[3-(trifluoromethyl)phenyl]sulfanylphenyl]-2-methylpentan-1-ol |
| SMILES | CC(N)(CO)CCCc1ccc(Sc2cccc(C(F)(F)F)c2)cc1Cl |
| InChI | InChI=1S/C19H21ClF3NOS/c1-18(24,12-25)9-3-4-13-7-8-16(11-17(13)20)26-15-6-2-5-14(10-15)19(21,22)23/h2,5-8,10-11,25H,3-4,9,12,24H2,1H3 |
| InChIKey | RMBCHWDOPZIQDJ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.90 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |