C8H16O6 — CID 23399208
methyl 4-hydroperoxy-4,4-dihydroxy-2-propan-2-ylbutanoate (PubChem CID 23399208) has the molecular formula C8H16O6 and a molecular weight of 208.21 g/mol. Its IUPAC name is methyl 4-hydroperoxy-4,4-dihydroxy-2-propan-2-ylbutanoate.
| Compound Name | methyl 4-hydroperoxy-4,4-dihydroxy-2-propan-2-ylbutanoate |
|---|---|
| PubChem CID | 23399208 |
| Molecular Formula | C8H16O6 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | methyl 4-hydroperoxy-4,4-dihydroxy-2-propan-2-ylbutanoate |
| SMILES | COC(=O)C(CC(O)(O)OO)C(C)C |
| InChI | InChI=1S/C8H16O6/c1-5(2)6(7(9)13-3)4-8(10,11)14-12/h5-6,10-12H,4H2,1-3H3 |
| InChIKey | AMOWMDXUWBSAGL-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|