C16H29BrO5 — CID 59412362
dimethyl (2S,5S,7S)-4-bromo-5-hydroxy-2,7-di(propan-2-yl)octanedioate (PubChem CID 59412362) has the molecular formula C16H29BrO5 and a molecular weight of 381.31 g/mol. Its IUPAC name is dimethyl (2S,5S,7S)-4-bromo-5-hydroxy-2,7-di(propan-2-yl)octanedioate.
| Compound Name | dimethyl (2S,5S,7S)-4-bromo-5-hydroxy-2,7-di(propan-2-yl)octanedioate |
|---|---|
| PubChem CID | 59412362 |
| Molecular Formula | C16H29BrO5 |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | dimethyl (2S,5S,7S)-4-bromo-5-hydroxy-2,7-di(propan-2-yl)octanedioate |
| SMILES | COC(=O)[C@@H](CC(Br)[C@@H](O)C[C@H](C(=O)OC)C(C)C)C(C)C |
| InChI | InChI=1S/C16H29BrO5/c1-9(2)11(15(19)21-5)7-13(17)14(18)8-12(10(3)4)16(20)22-6/h9-14,18H,7-8H2,1-6H3/t11-,12-,13?,14-/m0/s1 |
| InChIKey | WUPFHQUKOARFFH-JZUWIAGASA-N |
| XLogP | 2.78 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|