C17H25ClN2O3S — CID 23400440
2-acetamido-N-[(2-chloro-4-propan-2-ylphenyl)methyl]-4-methylsulfinylbutanamide (PubChem CID 23400440) has the molecular formula C17H25ClN2O3S and a molecular weight of 372.92 g/mol. Its IUPAC name is 2-acetamido-N-[(2-chloro-4-propan-2-ylphenyl)methyl]-4-methylsulfinylbutanamide.
| Compound Name | 2-acetamido-N-[(2-chloro-4-propan-2-ylphenyl)methyl]-4-methylsulfinylbutanamide |
|---|---|
| PubChem CID | 23400440 |
| Molecular Formula | C17H25ClN2O3S |
| Molecular Weight | 372.92 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 2-acetamido-N-[(2-chloro-4-propan-2-ylphenyl)methyl]-4-methylsulfinylbutanamide |
| SMILES | CC(=O)NC(CCS(C)=O)C(=O)NCc1ccc(C(C)C)cc1Cl |
| InChI | InChI=1S/C17H25ClN2O3S/c1-11(2)13-5-6-14(15(18)9-13)10-19-17(22)16(20-12(3)21)7-8-24(4)23/h5-6,9,11,16H,7-8,10H2,1-4H3,(H,19,22)(H,20,21) |
| InChIKey | HQSKUUBIXPMLHO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.92 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |