C13H18Cl2N2O2S — CID 75520506
1-[1-(3,4-dichlorophenyl)ethyl]-3-(1-methylsulfinylpropan-2-yl)urea (PubChem CID 75520506) has the molecular formula C13H18Cl2N2O2S and a molecular weight of 337.27 g/mol. Its IUPAC name is 1-[1-(3,4-dichlorophenyl)ethyl]-3-(1-methylsulfinylpropan-2-yl)urea.
| Compound Name | 1-[1-(3,4-dichlorophenyl)ethyl]-3-(1-methylsulfinylpropan-2-yl)urea |
|---|---|
| PubChem CID | 75520506 |
| Molecular Formula | C13H18Cl2N2O2S |
| Molecular Weight | 337.27 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 1-[1-(3,4-dichlorophenyl)ethyl]-3-(1-methylsulfinylpropan-2-yl)urea |
| SMILES | CC(CS(C)=O)NC(=O)NC(C)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H18Cl2N2O2S/c1-8(7-20(3)19)16-13(18)17-9(2)10-4-5-11(14)12(15)6-10/h4-6,8-9H,7H2,1-3H3,(H2,16,17,18) |
| InChIKey | AXMZLXYSZVWVEG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.27 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |