C26H56N6O — CID 23400708
2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-6-(3,7-dimethyloct-6-enylamino)hexanamide (PubChem CID 23400708) has the molecular formula C26H56N6O and a molecular weight of 468.78 g/mol. Its IUPAC name is 2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-6-(3,7-dimethyloct-6-enylamino)hexanamide.
| Compound Name | 2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-6-(3,7-dimethyloct-6-enylamino)hexanamide |
|---|---|
| PubChem CID | 23400708 |
| Molecular Formula | C26H56N6O |
| Molecular Weight | 468.78 g/mol |
| Exact Mass | 468.45 |
| IUPAC Name | 2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-6-(3,7-dimethyloct-6-enylamino)hexanamide |
| SMILES | CC(C)=CCCC(C)CCNCCCCC(N)C(=O)NCCCNCCCCNCCCN |
| InChI | InChI=1S/C26H56N6O/c1-23(2)11-8-12-24(3)14-22-31-16-5-4-13-25(28)26(33)32-21-10-20-30-18-7-6-17-29-19-9-15-27/h11,24-25,29-31H,4-10,12-22,27-28H2,1-3H3,(H,32,33) |
| InChIKey | SRTXRGKNBOPWCA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.78 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|