C20H40O2 — CID 23401616
(5S,6R)-5-heptyl-6-octyloxan-2-ol (PubChem CID 23401616) has the molecular formula C20H40O2 and a molecular weight of 312.54 g/mol. Its IUPAC name is (5S,6R)-5-heptyl-6-octyloxan-2-ol.
| Compound Name | (5S,6R)-5-heptyl-6-octyloxan-2-ol |
|---|---|
| PubChem CID | 23401616 |
| Molecular Formula | C20H40O2 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.30 |
| IUPAC Name | (5S,6R)-5-heptyl-6-octyloxan-2-ol |
| SMILES | CCCCCCCC[C@H]1OC(O)CC[C@@H]1CCCCCCC |
| InChI | InChI=1S/C20H40O2/c1-3-5-7-9-11-13-15-19-18(16-17-20(21)22-19)14-12-10-8-6-4-2/h18-21H,3-17H2,1-2H3/t18-,19+,20?/m0/s1 |
| InChIKey | CVGVDJHFBKHLGU-ABZYKWASSA-N |
| XLogP | 6.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|