C17H12F4N2OS — CID 2340211
N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2,3,4,5-tetrafluorobenzamide (PubChem CID 2340211) has the molecular formula C17H12F4N2OS and a molecular weight of 368.36 g/mol. Its IUPAC name is N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2,3,4,5-tetrafluorobenzamide.
| Compound Name | N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2,3,4,5-tetrafluorobenzamide |
|---|---|
| PubChem CID | 2340211 |
| Molecular Formula | C17H12F4N2OS |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2,3,4,5-tetrafluorobenzamide |
| SMILES | N#Cc1c(NC(=O)c2cc(F)c(F)c(F)c2F)sc2c1CCCCC2 |
| InChI | InChI=1S/C17H12F4N2OS/c18-11-6-9(13(19)15(21)14(11)20)16(24)23-17-10(7-22)8-4-2-1-3-5-12(8)25-17/h6H,1-5H2,(H,23,24) |
| InChIKey | ZECMIJIGNAUJGD-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|