C17H30O2 — CID 23402619
3-butyl-5,6-ditert-butyl-2,3-dihydropyran-4-one (PubChem CID 23402619) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is 3-butyl-5,6-ditert-butyl-2,3-dihydropyran-4-one.
| Compound Name | 3-butyl-5,6-ditert-butyl-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 23402619 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 3-butyl-5,6-ditert-butyl-2,3-dihydropyran-4-one |
| SMILES | CCCCC1COC(C(C)(C)C)=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C17H30O2/c1-8-9-10-12-11-19-15(17(5,6)7)13(14(12)18)16(2,3)4/h12H,8-11H2,1-7H3 |
| InChIKey | LZQWRLCPHXJRMA-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |