C7H10O — CID 23403167
3-methylcyclohexa-2,4-dien-1-ol (PubChem CID 23403167) has the molecular formula C7H10O and a molecular weight of 110.16 g/mol. Its IUPAC name is 3-methylcyclohexa-2,4-dien-1-ol.
| Compound Name | 3-methylcyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 23403167 |
| Molecular Formula | C7H10O |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.07 |
| IUPAC Name | 3-methylcyclohexa-2,4-dien-1-ol |
| SMILES | CC1=CC(O)CC=C1 |
| InChI | InChI=1S/C7H10O/c1-6-3-2-4-7(8)5-6/h2-3,5,7-8H,4H2,1H3 |
| InChIKey | JUKDRAILSZBHDW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |