C7H10N2S2 — CID 23403399
5-methyl-4,6-bis(methylsulfanyl)pyrimidine (PubChem CID 23403399) has the molecular formula C7H10N2S2 and a molecular weight of 186.31 g/mol. Its IUPAC name is 5-methyl-4,6-bis(methylsulfanyl)pyrimidine.
| Compound Name | 5-methyl-4,6-bis(methylsulfanyl)pyrimidine |
|---|---|
| PubChem CID | 23403399 |
| Molecular Formula | C7H10N2S2 |
| Molecular Weight | 186.31 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | 5-methyl-4,6-bis(methylsulfanyl)pyrimidine |
| SMILES | CSc1ncnc(SC)c1C |
| InChI | InChI=1S/C7H10N2S2/c1-5-6(10-2)8-4-9-7(5)11-3/h4H,1-3H3 |
| InChIKey | GQNQLTOAODWZTB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |