C20H21N3O5S2 — CID 23406154
2-phenoxyethyl 2-[[5-(benzenesulfonylmethyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetate (PubChem CID 23406154) has the molecular formula C20H21N3O5S2 and a molecular weight of 447.54 g/mol. Its IUPAC name is 2-phenoxyethyl 2-[[5-(benzenesulfonylmethyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetate.
| Compound Name | 2-phenoxyethyl 2-[[5-(benzenesulfonylmethyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 23406154 |
| Molecular Formula | C20H21N3O5S2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | 2-phenoxyethyl 2-[[5-(benzenesulfonylmethyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetate |
| SMILES | Cn1c(CS(=O)(=O)c2ccccc2)nnc1SCC(=O)OCCOc1ccccc1 |
| InChI | InChI=1S/C20H21N3O5S2/c1-23-18(15-30(25,26)17-10-6-3-7-11-17)21-22-20(23)29-14-19(24)28-13-12-27-16-8-4-2-5-9-16/h2-11H,12-15H2,1H3 |
| InChIKey | LFFLLXIIZVZOPP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 100.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|