C25H25N3O3S2 — CID 23406938
3-(benzenesulfonylmethyl)-5-(4-phenoxybutylsulfanyl)-4-phenyl-1,2,4-triazole (PubChem CID 23406938) has the molecular formula C25H25N3O3S2 and a molecular weight of 479.63 g/mol. Its IUPAC name is 3-(benzenesulfonylmethyl)-5-(4-phenoxybutylsulfanyl)-4-phenyl-1,2,4-triazole.
| Compound Name | 3-(benzenesulfonylmethyl)-5-(4-phenoxybutylsulfanyl)-4-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 23406938 |
| Molecular Formula | C25H25N3O3S2 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | 3-(benzenesulfonylmethyl)-5-(4-phenoxybutylsulfanyl)-4-phenyl-1,2,4-triazole |
| SMILES | O=S(=O)(Cc1nnc(SCCCCOc2ccccc2)n1-c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H25N3O3S2/c29-33(30,23-16-8-3-9-17-23)20-24-26-27-25(28(24)21-12-4-1-5-13-21)32-19-11-10-18-31-22-14-6-2-7-15-22/h1-9,12-17H,10-11,18-20H2 |
| InChIKey | YQVVQMNQTYNGDM-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|