C24H23N3O2S2 — CID 23406819
3-(benzenesulfonylmethyl)-4-phenyl-5-(3-phenylpropylsulfanyl)-1,2,4-triazole (PubChem CID 23406819) has the molecular formula C24H23N3O2S2 and a molecular weight of 449.60 g/mol. Its IUPAC name is 3-(benzenesulfonylmethyl)-4-phenyl-5-(3-phenylpropylsulfanyl)-1,2,4-triazole.
| Compound Name | 3-(benzenesulfonylmethyl)-4-phenyl-5-(3-phenylpropylsulfanyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 23406819 |
| Molecular Formula | C24H23N3O2S2 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 3-(benzenesulfonylmethyl)-4-phenyl-5-(3-phenylpropylsulfanyl)-1,2,4-triazole |
| SMILES | O=S(=O)(Cc1nnc(SCCCc2ccccc2)n1-c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H23N3O2S2/c28-31(29,22-16-8-3-9-17-22)19-23-25-26-24(27(23)21-14-6-2-7-15-21)30-18-10-13-20-11-4-1-5-12-20/h1-9,11-12,14-17H,10,13,18-19H2 |
| InChIKey | CPNCKQXDUXUFDG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|