C21H19N5O3S3 — CID 23406742
2-[[5-(benzenesulfonylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-benzothiazol-2-yl)acetamide (PubChem CID 23406742) has the molecular formula C21H19N5O3S3 and a molecular weight of 485.62 g/mol. Its IUPAC name is 2-[[5-(benzenesulfonylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-[[5-(benzenesulfonylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 23406742 |
| Molecular Formula | C21H19N5O3S3 |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | 2-[[5-(benzenesulfonylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-benzothiazol-2-yl)acetamide |
| SMILES | C=CCn1c(CS(=O)(=O)c2ccccc2)nnc1SCC(=O)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C21H19N5O3S3/c1-2-12-26-18(14-32(28,29)15-8-4-3-5-9-15)24-25-21(26)30-13-19(27)23-20-22-16-10-6-7-11-17(16)31-20/h2-11H,1,12-14H2,(H,22,23,27) |
| InChIKey | VDXAMGPIKGIWHN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|