C27H31N3O4S — CID 23408465
6-[2-(7-tert-butyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetyl]-4-propyl-1,4-benzoxazin-3-one (PubChem CID 23408465) has the molecular formula C27H31N3O4S and a molecular weight of 493.63 g/mol. Its IUPAC name is 6-[2-(7-tert-butyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetyl]-4-propyl-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-(7-tert-butyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetyl]-4-propyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 23408465 |
| Molecular Formula | C27H31N3O4S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 6-[2-(7-tert-butyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetyl]-4-propyl-1,4-benzoxazin-3-one |
| SMILES | CCCN1C(=O)COc2ccc(C(=O)Cn3cnc4sc5c(c4c3=O)CCC(C(C)(C)C)C5)cc21 |
| InChI | InChI=1S/C27H31N3O4S/c1-5-10-30-19-11-16(6-9-21(19)34-14-23(30)32)20(31)13-29-15-28-25-24(26(29)33)18-8-7-17(27(2,3)4)12-22(18)35-25/h6,9,11,15,17H,5,7-8,10,12-14H2,1-4H3 |
| InChIKey | OYYGZFZJWZGUFP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |