C28H25N3O4S — CID 23408547
6-[2-[4-oxo-5-(4-propan-2-ylphenyl)thieno[2,3-d]pyrimidin-3-yl]acetyl]-4-prop-2-enyl-1,4-benzoxazin-3-one (PubChem CID 23408547) has the molecular formula C28H25N3O4S and a molecular weight of 499.59 g/mol. Its IUPAC name is 6-[2-[4-oxo-5-(4-propan-2-ylphenyl)thieno[2,3-d]pyrimidin-3-yl]acetyl]-4-prop-2-enyl-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-[4-oxo-5-(4-propan-2-ylphenyl)thieno[2,3-d]pyrimidin-3-yl]acetyl]-4-prop-2-enyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 23408547 |
| Molecular Formula | C28H25N3O4S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | 6-[2-[4-oxo-5-(4-propan-2-ylphenyl)thieno[2,3-d]pyrimidin-3-yl]acetyl]-4-prop-2-enyl-1,4-benzoxazin-3-one |
| SMILES | C=CCN1C(=O)COc2ccc(C(=O)Cn3cnc4scc(-c5ccc(C(C)C)cc5)c4c3=O)cc21 |
| InChI | InChI=1S/C28H25N3O4S/c1-4-11-31-22-12-20(9-10-24(22)35-14-25(31)33)23(32)13-30-16-29-27-26(28(30)34)21(15-36-27)19-7-5-18(6-8-19)17(2)3/h4-10,12,15-17H,1,11,13-14H2,2-3H3 |
| InChIKey | UJVKHTWCSBAMBU-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|