C16H13F2NO4S — CID 23409059
N-(4-fluorophenyl)-2-[2-(4-fluorophenyl)-2-oxoethyl]sulfonylacetamide (PubChem CID 23409059) has the molecular formula C16H13F2NO4S and a molecular weight of 353.35 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[2-(4-fluorophenyl)-2-oxoethyl]sulfonylacetamide.
| Compound Name | N-(4-fluorophenyl)-2-[2-(4-fluorophenyl)-2-oxoethyl]sulfonylacetamide |
|---|---|
| PubChem CID | 23409059 |
| Molecular Formula | C16H13F2NO4S |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | N-(4-fluorophenyl)-2-[2-(4-fluorophenyl)-2-oxoethyl]sulfonylacetamide |
| SMILES | O=C(CS(=O)(=O)CC(=O)c1ccc(F)cc1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C16H13F2NO4S/c17-12-3-1-11(2-4-12)15(20)9-24(22,23)10-16(21)19-14-7-5-13(18)6-8-14/h1-8H,9-10H2,(H,19,21) |
| InChIKey | MVRAQZQSSAQGCF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |