C13H15FN2O4S — CID 39083672
N-cyclopropyl-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfonylacetamide (PubChem CID 39083672) has the molecular formula C13H15FN2O4S and a molecular weight of 314.34 g/mol. Its IUPAC name is N-cyclopropyl-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfonylacetamide.
| Compound Name | N-cyclopropyl-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfonylacetamide |
|---|---|
| PubChem CID | 39083672 |
| Molecular Formula | C13H15FN2O4S |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | N-cyclopropyl-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfonylacetamide |
| SMILES | O=C(CS(=O)(=O)CC(=O)NC1CC1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C13H15FN2O4S/c14-9-1-3-10(4-2-9)15-12(17)7-21(19,20)8-13(18)16-11-5-6-11/h1-4,11H,5-8H2,(H,15,17)(H,16,18) |
| InChIKey | JMZXIYWVGQKZHU-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |