C16H20FN3O5S — CID 39083675
1-[2-[2-(4-fluoroanilino)-2-oxoethyl]sulfonylacetyl]piperidine-4-carboxamide (PubChem CID 39083675) has the molecular formula C16H20FN3O5S and a molecular weight of 385.42 g/mol. Its IUPAC name is 1-[2-[2-(4-fluoroanilino)-2-oxoethyl]sulfonylacetyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-[2-(4-fluoroanilino)-2-oxoethyl]sulfonylacetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 39083675 |
| Molecular Formula | C16H20FN3O5S |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 1-[2-[2-(4-fluoroanilino)-2-oxoethyl]sulfonylacetyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)CS(=O)(=O)CC(=O)Nc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H20FN3O5S/c17-12-1-3-13(4-2-12)19-14(21)9-26(24,25)10-15(22)20-7-5-11(6-8-20)16(18)23/h1-4,11H,5-10H2,(H2,18,23)(H,19,21) |
| InChIKey | JDUOTYCJOIDSNN-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |