C26H22ClN3O6S — CID 23409416
2-methoxyethyl 3-[2-(2-benzoyl-4-chloroanilino)-2-oxoethyl]-5-methyl-4-oxothieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 23409416) has the molecular formula C26H22ClN3O6S and a molecular weight of 540.00 g/mol. Its IUPAC name is 2-methoxyethyl 3-[2-(2-benzoyl-4-chloroanilino)-2-oxoethyl]-5-methyl-4-oxothieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | 2-methoxyethyl 3-[2-(2-benzoyl-4-chloroanilino)-2-oxoethyl]-5-methyl-4-oxothieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 23409416 |
| Molecular Formula | C26H22ClN3O6S |
| Molecular Weight | 540.00 g/mol |
| Exact Mass | 539.09 |
| IUPAC Name | 2-methoxyethyl 3-[2-(2-benzoyl-4-chloroanilino)-2-oxoethyl]-5-methyl-4-oxothieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | COCCOC(=O)c1sc2ncn(CC(=O)Nc3ccc(Cl)cc3C(=O)c3ccccc3)c(=O)c2c1C |
| InChI | InChI=1S/C26H22ClN3O6S/c1-15-21-24(37-23(15)26(34)36-11-10-35-2)28-14-30(25(21)33)13-20(31)29-19-9-8-17(27)12-18(19)22(32)16-6-4-3-5-7-16/h3-9,12,14H,10-11,13H2,1-2H3,(H,29,31) |
| InChIKey | XIQZKSZWTFQMIF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.00 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|