C24H19Cl2N3O5S — CID 44640290
2-phenoxyethyl 3-[2-(2,4-dichloroanilino)-2-oxoethyl]-5-methyl-4-oxothieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 44640290) has the molecular formula C24H19Cl2N3O5S and a molecular weight of 532.41 g/mol. Its IUPAC name is 2-phenoxyethyl 3-[2-(2,4-dichloroanilino)-2-oxoethyl]-5-methyl-4-oxothieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | 2-phenoxyethyl 3-[2-(2,4-dichloroanilino)-2-oxoethyl]-5-methyl-4-oxothieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 44640290 |
| Molecular Formula | C24H19Cl2N3O5S |
| Molecular Weight | 532.41 g/mol |
| Exact Mass | 531.04 |
| IUPAC Name | 2-phenoxyethyl 3-[2-(2,4-dichloroanilino)-2-oxoethyl]-5-methyl-4-oxothieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | Cc1c(C(=O)OCCOc2ccccc2)sc2ncn(CC(=O)Nc3ccc(Cl)cc3Cl)c(=O)c12 |
| InChI | InChI=1S/C24H19Cl2N3O5S/c1-14-20-22(35-21(14)24(32)34-10-9-33-16-5-3-2-4-6-16)27-13-29(23(20)31)12-19(30)28-18-8-7-15(25)11-17(18)26/h2-8,11,13H,9-10,12H2,1H3,(H,28,30) |
| InChIKey | ONJKMVZZILFBNE-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.41 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|