C17H16N4O4S — CID 23410167
N-(3-nitrophenyl)-2-(2,5,6-trimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetamide (PubChem CID 23410167) has the molecular formula C17H16N4O4S and a molecular weight of 372.41 g/mol. Its IUPAC name is N-(3-nitrophenyl)-2-(2,5,6-trimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetamide.
| Compound Name | N-(3-nitrophenyl)-2-(2,5,6-trimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetamide |
|---|---|
| PubChem CID | 23410167 |
| Molecular Formula | C17H16N4O4S |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | N-(3-nitrophenyl)-2-(2,5,6-trimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetamide |
| SMILES | Cc1sc2nc(C)n(CC(=O)Nc3cccc([N+](=O)[O-])c3)c(=O)c2c1C |
| InChI | InChI=1S/C17H16N4O4S/c1-9-10(2)26-16-15(9)17(23)20(11(3)18-16)8-14(22)19-12-5-4-6-13(7-12)21(24)25/h4-7H,8H2,1-3H3,(H,19,22) |
| InChIKey | SEYLPJAFOSCITE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|