C18H17N5O6 — CID 41157780
2-(5-methoxy-1,6-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-3-yl)-N-(3-nitrophenyl)acetamide (PubChem CID 41157780) has the molecular formula C18H17N5O6 and a molecular weight of 399.36 g/mol. Its IUPAC name is 2-(5-methoxy-1,6-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-3-yl)-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-(5-methoxy-1,6-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-3-yl)-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 41157780 |
| Molecular Formula | C18H17N5O6 |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 2-(5-methoxy-1,6-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-3-yl)-N-(3-nitrophenyl)acetamide |
| SMILES | COc1c(C)cnc2c1c(=O)n(CC(=O)Nc1cccc([N+](=O)[O-])c1)c(=O)n2C |
| InChI | InChI=1S/C18H17N5O6/c1-10-8-19-16-14(15(10)29-3)17(25)22(18(26)21(16)2)9-13(24)20-11-5-4-6-12(7-11)23(27)28/h4-8H,9H2,1-3H3,(H,20,24) |
| InChIKey | ZFVDLQMCPWTCQW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 138.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|