C18H18N4O5 — CID 26841454
5-ethoxy-1,6-dimethyl-3-[(3-nitrophenyl)methyl]pyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 26841454) has the molecular formula C18H18N4O5 and a molecular weight of 370.37 g/mol. Its IUPAC name is 5-ethoxy-1,6-dimethyl-3-[(3-nitrophenyl)methyl]pyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 5-ethoxy-1,6-dimethyl-3-[(3-nitrophenyl)methyl]pyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 26841454 |
| Molecular Formula | C18H18N4O5 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 5-ethoxy-1,6-dimethyl-3-[(3-nitrophenyl)methyl]pyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | CCOc1c(C)cnc2c1c(=O)n(Cc1cccc([N+](=O)[O-])c1)c(=O)n2C |
| InChI | InChI=1S/C18H18N4O5/c1-4-27-15-11(2)9-19-16-14(15)17(23)21(18(24)20(16)3)10-12-6-5-7-13(8-12)22(25)26/h5-9H,4,10H2,1-3H3 |
| InChIKey | QFUKVRBEARZCRP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 109.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|