C29H29N3O6S2 — CID 23410405
diethyl 3-methyl-5-[[2-[4-oxo-5-(5,6,7,8-tetrahydronaphthalen-2-yl)thieno[2,3-d]pyrimidin-3-yl]acetyl]amino]thiophene-2,4-dicarboxylate (PubChem CID 23410405) has the molecular formula C29H29N3O6S2 and a molecular weight of 579.70 g/mol. Its IUPAC name is diethyl 3-methyl-5-[[2-[4-oxo-5-(5,6,7,8-tetrahydronaphthalen-2-yl)thieno[2,3-d]pyrimidin-3-yl]acetyl]amino]thiophene-2,4-dicarboxylate.
| Compound Name | diethyl 3-methyl-5-[[2-[4-oxo-5-(5,6,7,8-tetrahydronaphthalen-2-yl)thieno[2,3-d]pyrimidin-3-yl]acetyl]amino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 23410405 |
| Molecular Formula | C29H29N3O6S2 |
| Molecular Weight | 579.70 g/mol |
| Exact Mass | 579.15 |
| IUPAC Name | diethyl 3-methyl-5-[[2-[4-oxo-5-(5,6,7,8-tetrahydronaphthalen-2-yl)thieno[2,3-d]pyrimidin-3-yl]acetyl]amino]thiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)Cn2cnc3scc(-c4ccc5c(c4)CCCC5)c3c2=O)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C29H29N3O6S2/c1-4-37-28(35)22-16(3)24(29(36)38-5-2)40-26(22)31-21(33)13-32-15-30-25-23(27(32)34)20(14-39-25)19-11-10-17-8-6-7-9-18(17)12-19/h10-12,14-15H,4-9,13H2,1-3H3,(H,31,33) |
| InChIKey | SNEBIUGKXPNOLU-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.70 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |