C21H19N5O2S2 — CID 28528137
N-(5-methyl-1,3,4-thiadiazol-2-yl)-2-[4-oxo-5-(5,6,7,8-tetrahydronaphthalen-2-yl)thieno[2,3-d]pyrimidin-3-yl]acetamide (PubChem CID 28528137) has the molecular formula C21H19N5O2S2 and a molecular weight of 437.55 g/mol. Its IUPAC name is N-(5-methyl-1,3,4-thiadiazol-2-yl)-2-[4-oxo-5-(5,6,7,8-tetrahydronaphthalen-2-yl)thieno[2,3-d]pyrimidin-3-yl]acetamide.
| Compound Name | N-(5-methyl-1,3,4-thiadiazol-2-yl)-2-[4-oxo-5-(5,6,7,8-tetrahydronaphthalen-2-yl)thieno[2,3-d]pyrimidin-3-yl]acetamide |
|---|---|
| PubChem CID | 28528137 |
| Molecular Formula | C21H19N5O2S2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | N-(5-methyl-1,3,4-thiadiazol-2-yl)-2-[4-oxo-5-(5,6,7,8-tetrahydronaphthalen-2-yl)thieno[2,3-d]pyrimidin-3-yl]acetamide |
| SMILES | Cc1nnc(NC(=O)Cn2cnc3scc(-c4ccc5c(c4)CCCC5)c3c2=O)s1 |
| InChI | InChI=1S/C21H19N5O2S2/c1-12-24-25-21(30-12)23-17(27)9-26-11-22-19-18(20(26)28)16(10-29-19)15-7-6-13-4-2-3-5-14(13)8-15/h6-8,10-11H,2-5,9H2,1H3,(H,23,25,27) |
| InChIKey | DVXMTQKBVKSLBE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |