C21H19N5O2S3 — CID 28528430
N-(5-methyl-1,3,4-thiadiazol-2-yl)-2-[[4-oxo-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-3H-thieno[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide (PubChem CID 28528430) has the molecular formula C21H19N5O2S3 and a molecular weight of 469.62 g/mol. Its IUPAC name is N-(5-methyl-1,3,4-thiadiazol-2-yl)-2-[[4-oxo-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-3H-thieno[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide.
| Compound Name | N-(5-methyl-1,3,4-thiadiazol-2-yl)-2-[[4-oxo-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-3H-thieno[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 28528430 |
| Molecular Formula | C21H19N5O2S3 |
| Molecular Weight | 469.62 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | N-(5-methyl-1,3,4-thiadiazol-2-yl)-2-[[4-oxo-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-3H-thieno[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide |
| SMILES | Cc1nnc(NC(=O)CSc2nc3scc(-c4ccc5c(c4)CCCC5)c3c(=O)[nH]2)s1 |
| InChI | InChI=1S/C21H19N5O2S3/c1-11-25-26-21(31-11)22-16(27)10-30-20-23-18(28)17-15(9-29-19(17)24-20)14-7-6-12-4-2-3-5-13(12)8-14/h6-9H,2-5,10H2,1H3,(H,22,26,27)(H,23,24,28) |
| InChIKey | YWROTENHJXOONO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.62 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |