C21H18N4O2S3 — CID 2076172
2-[[4-oxo-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-3H-thieno[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 2076172) has the molecular formula C21H18N4O2S3 and a molecular weight of 454.60 g/mol. Its IUPAC name is 2-[[4-oxo-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-3H-thieno[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[[4-oxo-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-3H-thieno[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 2076172 |
| Molecular Formula | C21H18N4O2S3 |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | 2-[[4-oxo-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-3H-thieno[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(CSc1nc2scc(-c3ccc4c(c3)CCCC4)c2c(=O)[nH]1)Nc1nccs1 |
| InChI | InChI=1S/C21H18N4O2S3/c26-16(23-20-22-7-8-28-20)11-30-21-24-18(27)17-15(10-29-19(17)25-21)14-6-5-12-3-1-2-4-13(12)9-14/h5-10H,1-4,11H2,(H,22,23,26)(H,24,25,27) |
| InChIKey | CKDPJHDWPVANIV-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |