C26H26N2O3S2 — CID 23411591
2-[3-(4-methoxyphenoxy)propylsulfanyl]-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 23411591) has the molecular formula C26H26N2O3S2 and a molecular weight of 478.64 g/mol. Its IUPAC name is 2-[3-(4-methoxyphenoxy)propylsulfanyl]-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[3-(4-methoxyphenoxy)propylsulfanyl]-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 23411591 |
| Molecular Formula | C26H26N2O3S2 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 2-[3-(4-methoxyphenoxy)propylsulfanyl]-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | COc1ccc(OCCCSc2nc3scc(-c4ccc5c(c4)CCCC5)c3c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C26H26N2O3S2/c1-30-20-9-11-21(12-10-20)31-13-4-14-32-26-27-24(29)23-22(16-33-25(23)28-26)19-8-7-17-5-2-3-6-18(17)15-19/h7-12,15-16H,2-6,13-14H2,1H3,(H,27,28,29) |
| InChIKey | ZJTNQSOXGRKGJU-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|