C20H22N2OS2 — CID 23411334
7-methyl-2-(3-phenylpropylsulfanyl)-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 23411334) has the molecular formula C20H22N2OS2 and a molecular weight of 370.54 g/mol. Its IUPAC name is 7-methyl-2-(3-phenylpropylsulfanyl)-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 7-methyl-2-(3-phenylpropylsulfanyl)-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 23411334 |
| Molecular Formula | C20H22N2OS2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 7-methyl-2-(3-phenylpropylsulfanyl)-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CC1CCc2c(sc3nc(SCCCc4ccccc4)[nH]c(=O)c23)C1 |
| InChI | InChI=1S/C20H22N2OS2/c1-13-9-10-15-16(12-13)25-19-17(15)18(23)21-20(22-19)24-11-5-8-14-6-3-2-4-7-14/h2-4,6-7,13H,5,8-12H2,1H3,(H,21,22,23) |
| InChIKey | ZMPYBHOHPGZRCI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|