C22H26N2O2S2 — CID 7575548
(7S)-7-methyl-2-[4-(4-methylphenoxy)butylsulfanyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 7575548) has the molecular formula C22H26N2O2S2 and a molecular weight of 414.60 g/mol. Its IUPAC name is (7S)-7-methyl-2-[4-(4-methylphenoxy)butylsulfanyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (7S)-7-methyl-2-[4-(4-methylphenoxy)butylsulfanyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 7575548 |
| Molecular Formula | C22H26N2O2S2 |
| Molecular Weight | 414.60 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | (7S)-7-methyl-2-[4-(4-methylphenoxy)butylsulfanyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1ccc(OCCCCSc2nc3sc4c(c3c(=O)[nH]2)CC[C@H](C)C4)cc1 |
| InChI | InChI=1S/C22H26N2O2S2/c1-14-5-8-16(9-6-14)26-11-3-4-12-27-22-23-20(25)19-17-10-7-15(2)13-18(17)28-21(19)24-22/h5-6,8-9,15H,3-4,7,10-13H2,1-2H3,(H,23,24,25)/t15-/m0/s1 |
| InChIKey | WKMRDJYVZNFOBR-HNNXBMFYSA-N |
| XLogP | 5.37 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.60 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|