C24H28N2O4S — CID 23411545
cyclohexyl 5-methyl-3-[3-(3-methylphenoxy)propyl]-4-oxothieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 23411545) has the molecular formula C24H28N2O4S and a molecular weight of 440.57 g/mol. Its IUPAC name is cyclohexyl 5-methyl-3-[3-(3-methylphenoxy)propyl]-4-oxothieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | cyclohexyl 5-methyl-3-[3-(3-methylphenoxy)propyl]-4-oxothieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 23411545 |
| Molecular Formula | C24H28N2O4S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | cyclohexyl 5-methyl-3-[3-(3-methylphenoxy)propyl]-4-oxothieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | Cc1cccc(OCCCn2cnc3sc(C(=O)OC4CCCCC4)c(C)c3c2=O)c1 |
| InChI | InChI=1S/C24H28N2O4S/c1-16-8-6-11-19(14-16)29-13-7-12-26-15-25-22-20(23(26)27)17(2)21(31-22)24(28)30-18-9-4-3-5-10-18/h6,8,11,14-15,18H,3-5,7,9-10,12-13H2,1-2H3 |
| InChIKey | VWDAKRFMYNZRAX-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|