C20H21ClN2O5S — CID 23411531
2-methoxyethyl 3-[3-(4-chlorophenoxy)propyl]-5-methyl-4-oxothieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 23411531) has the molecular formula C20H21ClN2O5S and a molecular weight of 436.92 g/mol. Its IUPAC name is 2-methoxyethyl 3-[3-(4-chlorophenoxy)propyl]-5-methyl-4-oxothieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | 2-methoxyethyl 3-[3-(4-chlorophenoxy)propyl]-5-methyl-4-oxothieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 23411531 |
| Molecular Formula | C20H21ClN2O5S |
| Molecular Weight | 436.92 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 2-methoxyethyl 3-[3-(4-chlorophenoxy)propyl]-5-methyl-4-oxothieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | COCCOC(=O)c1sc2ncn(CCCOc3ccc(Cl)cc3)c(=O)c2c1C |
| InChI | InChI=1S/C20H21ClN2O5S/c1-13-16-18(29-17(13)20(25)28-11-10-26-2)22-12-23(19(16)24)8-3-9-27-15-6-4-14(21)5-7-15/h4-7,12H,3,8-11H2,1-2H3 |
| InChIKey | LCDMQSPJWXBNPM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.92 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|