C23H20ClN3O3S — CID 40828625
3-[3-(4-chlorophenoxy)propyl]-5-methyl-4-oxo-N-phenylthieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 40828625) has the molecular formula C23H20ClN3O3S and a molecular weight of 453.95 g/mol. Its IUPAC name is 3-[3-(4-chlorophenoxy)propyl]-5-methyl-4-oxo-N-phenylthieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 3-[3-(4-chlorophenoxy)propyl]-5-methyl-4-oxo-N-phenylthieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 40828625 |
| Molecular Formula | C23H20ClN3O3S |
| Molecular Weight | 453.95 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | 3-[3-(4-chlorophenoxy)propyl]-5-methyl-4-oxo-N-phenylthieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccccc2)sc2ncn(CCCOc3ccc(Cl)cc3)c(=O)c12 |
| InChI | InChI=1S/C23H20ClN3O3S/c1-15-19-22(31-20(15)21(28)26-17-6-3-2-4-7-17)25-14-27(23(19)29)12-5-13-30-18-10-8-16(24)9-11-18/h2-4,6-11,14H,5,12-13H2,1H3,(H,26,28) |
| InChIKey | XURSVKKZBNVORK-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.95 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|