About 1-(6-methyl-3-oxo-2H-1,2,4-triazin-5-yl)piperidine-4-carboxamide
1-(6-methyl-3-oxo-2H-1,2,4-triazin-5-yl)piperidine-4-carboxamide (PubChem CID 23412058) has the molecular formula C10H15N5O2
and a molecular weight of 237.26 g/mol. Its IUPAC name is 1-(6-methyl-3-oxo-2H-1,2,4-triazin-5-yl)piperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-(6-methyl-3-oxo-2H-1,2,4-triazin-5-yl)piperidine-4-carboxamide |
| PubChem CID | 23412058 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 1-(6-methyl-3-oxo-2H-1,2,4-triazin-5-yl)piperidine-4-carboxamide |
| SMILES | Cc1n[nH]c(=O)nc1N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C10H15N5O2/c1-6-9(12-10(17)14-13-6)15-4-2-7(3-5-15)8(11)16/h7H,2-5H2,1H3,(H2,11,16)(H,12,14,17) |
| InChIKey | HRXZBKZNYWKBFI-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(6-methyl-3-oxo-2H-1,2,4-triazin-5-yl)piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-methyl-3-oxo-2H-1,2,4-triazin-5-yl)piperidine-4-carboxamide?
The IUPAC name of 1-(6-methyl-3-oxo-2H-1,2,4-triazin-5-yl)piperidine-4-carboxamide (CID 23412058) is 1-(6-methyl-3-oxo-2H-1,2,4-triazin-5-yl)piperidine-4-carboxamide.
What is the SMILES notation for 1-(6-methyl-3-oxo-2H-1,2,4-triazin-5-yl)piperidine-4-carboxamide?
The canonical SMILES for 1-(6-methyl-3-oxo-2H-1,2,4-triazin-5-yl)piperidine-4-carboxamide is Cc1n[nH]c(=O)nc1N1CCC(C(N)=O)CC1.
What is the InChIKey of 1-(6-methyl-3-oxo-2H-1,2,4-triazin-5-yl)piperidine-4-carboxamide?
The InChIKey is HRXZBKZNYWKBFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N5O2/c1-6-9(12-10(17)14-13-6)15-4-2-7(3-5-15)8(11)16/h7H,2-5H2,1H3,(H2,11,16)(H,12,14,17).
What are the key properties of 1-(6-methyl-3-oxo-2H-1,2,4-triazin-5-yl)piperidine-4-carboxamide?
1-(6-methyl-3-oxo-2H-1,2,4-triazin-5-yl)piperidine-4-carboxamide has a molecular weight of 237.26 g/mol, XLogP of -0.82, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-methyl-3-oxo-2H-1,2,4-triazin-5-yl)piperidine-4-carboxamide is sourced from PubChem (CID 23412058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).