About tris[[dimethyl(phenyl)-λ5-phosphanylidene]amino]-methylphosphanium
tris[[dimethyl(phenyl)-λ5-phosphanylidene]amino]-methylphosphanium (PubChem CID 23415148) has the molecular formula C25H36N3P4+
and a molecular weight of 502.48 g/mol. Its IUPAC name is tris[[dimethyl(phenyl)-λ5-phosphanylidene]amino]-methylphosphanium.
Molecular Properties
| Compound Name | tris[[dimethyl(phenyl)-λ5-phosphanylidene]amino]-methylphosphanium |
| PubChem CID | 23415148 |
| Molecular Formula | C25H36N3P4+ |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | tris[[dimethyl(phenyl)-λ5-phosphanylidene]amino]-methylphosphanium |
| SMILES | CP(C)(=N[P+](C)(N=P(C)(C)c1ccccc1)N=P(C)(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H36N3P4/c1-29(2,23-17-11-8-12-18-23)26-32(7,27-30(3,4)24-19-13-9-14-20-24)28-31(5,6)25-21-15-10-16-22-25/h8-22H,1-7H3/q+1 |
| InChIKey | ZIWJFZUHENBBBW-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tris[[dimethyl(phenyl)-λ5-phosphanylidene]amino]-methylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris[[dimethyl(phenyl)-λ5-phosphanylidene]amino]-methylphosphanium?
The IUPAC name of tris[[dimethyl(phenyl)-λ5-phosphanylidene]amino]-methylphosphanium (CID 23415148) is tris[[dimethyl(phenyl)-λ5-phosphanylidene]amino]-methylphosphanium.
What is the SMILES notation for tris[[dimethyl(phenyl)-λ5-phosphanylidene]amino]-methylphosphanium?
The canonical SMILES for tris[[dimethyl(phenyl)-λ5-phosphanylidene]amino]-methylphosphanium is CP(C)(=N[P+](C)(N=P(C)(C)c1ccccc1)N=P(C)(C)c1ccccc1)c1ccccc1.
What is the InChIKey of tris[[dimethyl(phenyl)-λ5-phosphanylidene]amino]-methylphosphanium?
The InChIKey is ZIWJFZUHENBBBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H36N3P4/c1-29(2,23-17-11-8-12-18-23)26-32(7,27-30(3,4)24-19-13-9-14-20-24)28-31(5,6)25-21-15-10-16-22-25/h8-22H,1-7H3/q+1.
What are the key properties of tris[[dimethyl(phenyl)-λ5-phosphanylidene]amino]-methylphosphanium?
tris[[dimethyl(phenyl)-λ5-phosphanylidene]amino]-methylphosphanium has a molecular weight of 502.48 g/mol, XLogP of 7.74, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tris[[dimethyl(phenyl)-λ5-phosphanylidene]amino]-methylphosphanium is sourced from PubChem (CID 23415148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).