C16H29O7P — CID 23415642
diethyl (Z)-2-diethoxyphosphoryl-4,4-dimethylhex-2-enedioate (PubChem CID 23415642) has the molecular formula C16H29O7P and a molecular weight of 364.38 g/mol. Its IUPAC name is diethyl (Z)-2-diethoxyphosphoryl-4,4-dimethylhex-2-enedioate.
| Compound Name | diethyl (Z)-2-diethoxyphosphoryl-4,4-dimethylhex-2-enedioate |
|---|---|
| PubChem CID | 23415642 |
| Molecular Formula | C16H29O7P |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | diethyl (Z)-2-diethoxyphosphoryl-4,4-dimethylhex-2-enedioate |
| SMILES | CCOC(=O)CC(C)(C)/C=C(/C(=O)OCC)P(=O)(OCC)OCC |
| InChI | InChI=1S/C16H29O7P/c1-7-20-14(17)12-16(5,6)11-13(15(18)21-8-2)24(19,22-9-3)23-10-4/h11H,7-10,12H2,1-6H3/b13-11- |
| InChIKey | IRUYXEVWBJWXDH-QBFSEMIESA-N |
| XLogP | 3.68 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|