C17H27O7P — CID 176515756
ethyl (2E,5E)-3-diethoxyphosphoryl-8,8-dimethyl-4,7-dioxonona-2,5-dienoate (PubChem CID 176515756) has the molecular formula C17H27O7P and a molecular weight of 374.37 g/mol. Its IUPAC name is ethyl (2E,5E)-3-diethoxyphosphoryl-8,8-dimethyl-4,7-dioxonona-2,5-dienoate.
| Compound Name | ethyl (2E,5E)-3-diethoxyphosphoryl-8,8-dimethyl-4,7-dioxonona-2,5-dienoate |
|---|---|
| PubChem CID | 176515756 |
| Molecular Formula | C17H27O7P |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | ethyl (2E,5E)-3-diethoxyphosphoryl-8,8-dimethyl-4,7-dioxonona-2,5-dienoate |
| SMILES | CCOC(=O)/C=C(\C(=O)/C=C/C(=O)C(C)(C)C)P(=O)(OCC)OCC |
| InChI | InChI=1S/C17H27O7P/c1-7-22-16(20)12-14(25(21,23-8-2)24-9-3)13(18)10-11-15(19)17(4,5)6/h10-12H,7-9H2,1-6H3/b11-10+,14-12+ |
| InChIKey | IJEJSEBBATZEHK-CYZWUHAYSA-N |
| XLogP | 3.44 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|