C18H32O10P2 — CID 122635962
(5-diethoxyphosphorylcarbonyloxy-2,5-dimethylhex-3-yn-2-yl) diethoxyphosphorylformate (PubChem CID 122635962) has the molecular formula C18H32O10P2 and a molecular weight of 470.39 g/mol. Its IUPAC name is (5-diethoxyphosphorylcarbonyloxy-2,5-dimethylhex-3-yn-2-yl) diethoxyphosphorylformate.
| Compound Name | (5-diethoxyphosphorylcarbonyloxy-2,5-dimethylhex-3-yn-2-yl) diethoxyphosphorylformate |
|---|---|
| PubChem CID | 122635962 |
| Molecular Formula | C18H32O10P2 |
| Molecular Weight | 470.39 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | (5-diethoxyphosphorylcarbonyloxy-2,5-dimethylhex-3-yn-2-yl) diethoxyphosphorylformate |
| SMILES | CCOP(=O)(OCC)C(=O)OC(C)(C)C#CC(C)(C)OC(=O)P(=O)(OCC)OCC |
| InChI | InChI=1S/C18H32O10P2/c1-9-23-29(21,24-10-2)15(19)27-17(5,6)13-14-18(7,8)28-16(20)30(22,25-11-3)26-12-4/h9-12H2,1-8H3 |
| InChIKey | CJDPVCVPJPCMFT-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.39 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|