C9H19O9PS — CID 156690331
tert-butyl [ethoxy(2-sulfooxyethoxy)phosphoryl]formate (PubChem CID 156690331) has the molecular formula C9H19O9PS and a molecular weight of 334.28 g/mol. Its IUPAC name is tert-butyl [ethoxy(2-sulfooxyethoxy)phosphoryl]formate.
| Compound Name | tert-butyl [ethoxy(2-sulfooxyethoxy)phosphoryl]formate |
|---|---|
| PubChem CID | 156690331 |
| Molecular Formula | C9H19O9PS |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | tert-butyl [ethoxy(2-sulfooxyethoxy)phosphoryl]formate |
| SMILES | CCOP(=O)(OCCOS(=O)(=O)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H19O9PS/c1-5-15-19(11,8(10)18-9(2,3)4)16-6-7-17-20(12,13)14/h5-7H2,1-4H3,(H,12,13,14) |
| InChIKey | FPVMSSYCPUIEFE-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|